4509-90-4
| Name | 5-Bromovaleryl chloride |
| CAS | 4509-90-4 |
| EINECS(EC#) | 629-364-4 |
| Molecular Formula | C5H8BrClO |
| MDL Number | MFCD00013660 |
| Molecular Weight | 199.47 |
| MOL File | 4509-90-4.mol |
Chemical Properties
| Appearance | clear colorless to slightly yellow liquid |
| Boiling point | 116-118 °C/33 mmHg (lit.) |
| density | 1.49 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 225 °F |
| storage temp. | -20°C, sealed storage, away from moisture |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.49 |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive/Lachrymatory |
| InChI | InChI=1S/C5H8BrClO/c6-4-2-1-3-5(7)8/h1-4H2 |
| InChIKey | OKRUMSWHDWKGHA-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)CCCCBr |
| CAS DataBase Reference | 4509-90-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P261-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Corrosive/Lachrymatory/Moisture Sensitive |
| REACH Registrations | Active |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29159000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Skin Corr. 1B STOT SE 3 |