
4318-56-3
| Name | 6-Chloro-3-methyluracil |
| CAS | 4318-56-3 |
| EINECS(EC#) | 610-113-2 |
| Molecular Formula | C5H5ClN2O2 |
| MDL Number | MFCD01074837 |
| Molecular Weight | 160.56 |
| MOL File | 4318-56-3.mol |
Chemical Properties
| Melting point | 278-280°C (dec.) |
| density | 0,896 gr/cm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 7.16±0.40(Predicted) |
| color | White to Almost white |
| Detection Methods | HPLC,NMR |
| BRN | 511456 |
| InChI | InChI=1S/C5H5ClN2O2/c1-8-4(9)2-3(6)7-5(8)10/h2H,1H3,(H,7,10) |
| InChIKey | SGLXGFAZAARYJY-UHFFFAOYSA-N |
| SMILES | C1(=O)NC(Cl)=CC(=O)N1C |
| CAS DataBase Reference | 4318-56-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1992 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HS Code | 29335900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
