43100-38-5
| Name | 4-tert-Butylbenzhydrazide |
| CAS | 43100-38-5 |
| EINECS(EC#) | 256-090-9 |
| Molecular Formula | C11H16N2O |
| MDL Number | MFCD00014763 |
| Molecular Weight | 192.26 |
| MOL File | 43100-38-5.mol |
Chemical Properties
| Appearance | white to light beige crystalline powder or |
| Melting point | 120-127 °C(lit.) |
| density | 1.046±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 12.82±0.10(Predicted) |
| color | White to Almost white |
| BRN | 1104663 |
| InChI | InChI=1S/C11H16N2O/c1-11(2,3)9-6-4-8(5-7-9)10(14)13-12/h4-7H,12H2,1-3H3,(H,13,14) |
| InChIKey | XYUFQWDLRLHUPB-UHFFFAOYSA-N |
| SMILES | C(NN)(=O)C1=CC=C(C(C)(C)C)C=C1 |
| CAS DataBase Reference | 43100-38-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Tert-butylbenzoic acid hydrazide(43100-38-5) |
| EPA Substance Registry System | Benzoic acid, 4-(1,1-dimethylethyl)-, hydrazide (43100-38-5) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
