4282-31-9
| Name | 2,5-Thiophenedicarboxylic acid |
| CAS | 4282-31-9 |
| EINECS(EC#) | 224-284-2 |
| Molecular Formula | C6H4O4S |
| MDL Number | MFCD00016896 |
| Molecular Weight | 172.16 |
| MOL File | 4282-31-9.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | >300 °C (lit.) |
| Boiling point | 272.46°C (rough estimate) |
| density | 1.473 (estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | solid |
| pka | 2.76±0.10(Predicted) |
| color | White to Light yellow |
| Water Solubility | Very soluble in water. |
| BRN | 136781 |
| InChI | InChI=1S/C6H4O4S/c7-5(8)3-1-2-4(11-3)6(9)10/h1-2H,(H,7,8)(H,9,10) |
| InChIKey | YCGAZNXXGKTASZ-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)SC(C(O)=O)=CC=1 |
| CAS DataBase Reference | 4282-31-9(CAS DataBase Reference) |
| EPA Substance Registry System | 4282-31-9(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |