
42017-89-0
| Name | Fenofibric acid |
| CAS | 42017-89-0 |
| EINECS(EC#) | 255-626-9 |
| Molecular Formula | C17H15ClO4 |
| MDL Number | MFCD00792461 |
| Molecular Weight | 318.75 |
| MOL File | 42017-89-0.mol |
Chemical Properties
| Appearance | White to Off-White Solid |
| Melting point | 177-179°C |
| Boiling point | 486.5±35.0 °C(Predicted) |
| density | 1.286±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder |
| pka | 3.09±0.10(Predicted) |
| color | White to Off-White |
| Usage | Fenofibric acid, the active metabolite of fenofibrate. Increases Apolipoprotein A-Iediated High-Density Lipoprotein Biogenesis by enhancing transcription of ATP-Binding cassette transporter A1 gene in a liver X receptorependent manner |
| BRN | 2058973 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1S/C17H15ClO4/c1-17(2,16(20)21)22-14-9-5-12(6-10-14)15(19)11-3-7-13(18)8-4-11/h3-10H,1-2H3,(H,20,21) |
| InChIKey | MQOBSOSZFYZQOK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(OC1=CC=C(C(=O)C2=CC=C(Cl)C=C2)C=C1)(C)C |
| CAS DataBase Reference | 42017-89-0(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| RTECS | UA2453000 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Toxicity |