
41838-46-4
| Name | 1-Methylpiperidin-4-amine |
| CAS | 41838-46-4 |
| EINECS(EC#) | 628-217-1 |
| Molecular Formula | C6H14N2 |
| MDL Number | MFCD03426069 |
| Molecular Weight | 114.19 |
| MOL File | 41838-46-4.mol |
Chemical Properties
| Melting point | 203-207 |
| Boiling point | 62-64°C 1mm |
| density | 0.91 |
| refractive index | 1.4700-1.4740 |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| form | clear liquid |
| pka | 9.92±0.20(Predicted) |
| color | Colorless to Light orange to Yellow |
| Detection Methods | GC |
| InChI | InChI=1S/C6H14N2/c1-8-4-2-6(7)3-5-8/h6H,2-5,7H2,1H3 |
| InChIKey | ALOCUZOKRULSAA-UHFFFAOYSA-N |
| SMILES | N1(C)CCC(N)CC1 |
| CAS DataBase Reference | 41838-46-4(CAS DataBase Reference) |
| Storage Precautions | Store under nitrogen |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H314 |
| Precautionary statements | P210-P233-P240-P241+P242+P243-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P370+P378-P403+P235-P405-P501 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2920 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| PackingGroup | Ⅱ |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |

