4165-61-1
| Name | ANILINE D5 |
| CAS | 4165-61-1 |
| EINECS(EC#) | 224-015-9 |
| Molecular Formula | C6H2D5N |
| MDL Number | MFCD00044420 |
| Molecular Weight | 98.16 |
| MOL File | 4165-61-1.mol |
Chemical Properties
| Appearance | clear orange to yellow-brown liquid |
| Melting point | -6 °C(lit.) |
| Boiling point | 184 °C(lit.) |
| density | 1.076 g/mL at 25 °C |
| vapor density | 3.22 (184 °C, vs air) |
| vapor pressure | 0.7 mm Hg ( 25 °C) |
| refractive index | n |
| Fp | 158 °F |
| storage temp. | 2-8°C |
| solubility | DMF: 15 mg/ml,DMSO: 10 mg/ml,Ethanol: 3 mg/ml,PBS (pH 7.2): 5 mg/ml |
| form | Liquid |
| color | Clear orange to yellow-brown |
| explosive limit | 11% |
| BRN | 2208322 |
| Stability: | Air Sensitive, Material Darkens In Storage With No Loss In Purity, Material dark |
| InChI | 1S/C6H7N/c7-6-4-2-1-3-5-6/h1-5H,7H2/i1D,2D,3D,4D,5D |
| InChIKey | PAYRUJLWNCNPSJ-RALIUCGRSA-N |
| SMILES | [2H]c1c([2H])c([2H])c(N)c([2H])c1[2H] |
| EPA Substance Registry System | Phenyl-d5-amine (4165-61-1) |
Safety Data
| Symbol(GHS) |    GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H341-H351-H410 |
| Precautionary statements | P202-P273-P280-P301+P310-P302+P352+P312-P304+P340+P311 |
| Hazard Codes | T,N,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1547 6.1/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 6.1 |
| HS Code | 2845901000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Eye Dam. 1 Muta. 2 Skin Sens. 1 STOT RE 1 |