4107-65-7
| Name | 2,4-Dimethoxybenzonitrile |
| CAS | 4107-65-7 |
| EINECS(EC#) | 223-886-2 |
| Molecular Formula | C9H9NO2 |
| MDL Number | MFCD00001786 |
| Molecular Weight | 163.17 |
| MOL File | 4107-65-7.mol |
Chemical Properties
| Appearance | white to slightly yellow crystalline powder |
| Melting point | 93-94 °C (lit.) |
| Boiling point | 290.25°C (rough estimate) |
| density | 1.2021 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| color | White to slightly yellow |
| BRN | 1950512 |
| InChI | InChI=1S/C9H9NO2/c1-11-8-4-3-7(6-10)9(5-8)12-2/h3-5H,1-2H3 |
| InChIKey | RYRZSQQELLQCMZ-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(OC)C=C1OC |
| CAS DataBase Reference | 4107-65-7(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3276 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269095 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |