41044-12-6
| Name | Coumarin 30 |
| CAS | 41044-12-6 |
| EINECS(EC#) | 255-186-8 |
| Molecular Formula | C21H21N3O2 |
| MDL Number | MFCD00051349 |
| Molecular Weight | 347.41 |
| MOL File | 41044-12-6.mol |
Chemical Properties
| Appearance | bright yellow powder |
| Melting point | 225-229°C |
| Boiling point | 588.0±60.0 °C(Predicted) |
| density | 1.22±0.1 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| form | powder to crystal |
| pka | 4.70±0.10(Predicted) |
| color | Light yellow to Yellow to Green |
| λmax | 408nm(CH3CN)(lit.) |
| InChI | 1S/C21H21N3O2/c1-4-24(5-2)15-11-10-14-12-16(21(25)26-19(14)13-15)20-22-17-8-6-7-9-18(17)23(20)3/h6-13H,4-5H2,1-3H3 |
| InChIKey | KZFUMWVJJNDGAU-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc2C=C(C(=O)Oc2c1)c3nc4ccccc4n3C |
| EPA Substance Registry System | 2H-1-Benzopyran- 2-one, 7-(diethylamino)-3-(1-methyl- 1H-benzimidazol-2-yl)-(41044-12-6) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29322010 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |