4074-88-8
| Name | Diethylene glycol diacrylate |
| CAS | 4074-88-8 |
| EINECS(EC#) | 223-791-6 |
| Molecular Formula | C10H14O5 |
| MDL Number | MFCD00014939 |
| Molecular Weight | 214.22 |
| MOL File | 4074-88-8.mol |
Chemical Properties
| Appearance | colourless liquid |
| Melting point | >200℃/760mm |
| Boiling point | 162 °C(lit.) |
| density | 1.118 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | 2-8°C, stored under nitrogen |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Stability: | Stable. Incompatible with radical initiators, strong oxidizing agents, reducing agents, peroxides. Light sensitive. Polymerizes at elevated temperatures. |
| Water Solubility | Slightly soluble in water (1-5g/100ml at 18°C). |
| α-end | acrylate |
| Ω-end | acrylate |
| BRN | 1953711 |
| InChI | InChI=1S/C10H14O5/c1-3-9(11)14-7-5-13-6-8-15-10(12)4-2/h3-4H,1-2,5-8H2 |
| InChIKey | LEJBBGNFPAFPKQ-UHFFFAOYSA-N |
| SMILES | O(CCOC(=O)C=C)CCOC(=O)C=C |
| CAS DataBase Reference | 4074-88-8(CAS DataBase Reference) |
| EPA Substance Registry System | 4074-88-8(EPA Substance) |
Safety Data
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311-H315-H317-H318 |
| Precautionary statements | P261-P264-P280-P301+P310-P302+P352+P312-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2922 8/PG 3 |
| WGK Germany | 1 |
| RTECS | AS9450000 |
| TSCA | Yes |
| HS Code | 2916.12.5050 |
| HazardClass | 6.1 |
| PackingGroup | II |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 |
| Hazardous Substances Data | 4074-88-8(Hazardous Substances Data) |
| Toxicity |