
405224-23-9
| Name | 5-Bromo-2-chloro-3-cyanopyridine |
| CAS | 405224-23-9 |
| Molecular Formula | C6H2BrClN2 |
| MDL Number | MFCD09801046 |
| Molecular Weight | 217.45 |
| MOL File | 405224-23-9.mol |
Chemical Properties
| Melting point | 138.0 to 142.0 °C |
| Boiling point | 272.7±35.0 °C(Predicted) |
| density | 1.85±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Solid |
| pka | -4.56±0.10(Predicted) |
| color | White to Yellow to Green |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C6H2BrClN2/c7-5-1-4(2-9)6(8)10-3-5/h1,3H |
| InChIKey | MQOHJAYYYVQBSH-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(Br)C=C1C#N |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |

