
404844-02-6
| Name | N-Desmethyl Imatinib |
| CAS | 404844-02-6 |
| EINECS(EC#) | 1592732-453-0 |
| Molecular Formula | C28H29N7O |
| MDL Number | MFCD07369291 |
| Molecular Weight | 479.585 |
| MOL File | 404844-02-6.mol |
Chemical Properties
| Appearance | Off-White to Pale-Yellow Solid |
| Melting point | 99-101°C |
| density | 1.268±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | DMF: 16 mg/ml; DMF:PBS (pH 7.2) (1:4): 0.20 mg/ml; DMSO: 14 mg/ml; Ethanol: 0.20 mg/ml |
| form | A lyophilized solid |
| pka | 13.28±0.70(Predicted) |
| color | Light yellow to yellow |
| biological source | synthetic |
| InChIKey | BQQYXPHRXIZMDM-UHFFFAOYSA-N |
| SMILES | C(NC1=CC=C(C)C(NC2=NC=CC(C3=CC=CN=C3)=N2)=C1)(=O)C1=CC=C(CN2CCNCC2)C=C1 |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H341-H351-H360-H362 |
| Precautionary statements | P201-P202-P260-P263-P264-P270-P280-P301+P312-P330-P308+P313-P405-P501 |
| Safety Statements | |
| WGK Germany | WGK 3 |
| HS Code | 29339900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 2 Lact. Muta. 2 Repr. 1B |

