
403-19-0
| Name | 2-Fluoro-4-nitrophenol |
| CAS | 403-19-0 |
| Molecular Formula | C6H4FNO3 |
| MDL Number | MFCD00051970 |
| Molecular Weight | 157.1 |
| MOL File | 403-19-0.mol |
Chemical Properties
| Appearance | yellow crystalline powder |
| Melting point | 120-122 °C (lit.) |
| Boiling point | 281.2±25.0 °C(Predicted) |
| density | 1.4306 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 5.67±0.22(Predicted) |
| color | White to Light yellow |
| BRN | 1944995 |
| InChI | InChI=1S/C6H4FNO3/c7-5-3-4(8(10)11)1-2-6(5)9/h1-3,9H |
| InChIKey | ORPHLVJBJOCHBR-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C([N+]([O-])=O)C=C1F |
| CAS DataBase Reference | 403-19-0(CAS DataBase Reference) |
| EPA Substance Registry System | 403-19-0(EPA Substance) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29089990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |