39620-04-7
| Name | 2-Amino-3-chloropyridine |
| CAS | 39620-04-7 |
| Molecular Formula | C5H5ClN2 |
| MDL Number | MFCD03541052 |
| Molecular Weight | 128.56 |
| MOL File | 39620-04-7.mol |
Chemical Properties
| Melting point | 59-62℃ |
| Boiling point | 207.0±20.0 °C(Predicted) |
| density | 1.326±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | 4.14±0.36(Predicted) |
| color | White to Orange to Green |
| Detection Methods | HPLC |
| InChI | InChI=1S/C5H5ClN2/c6-4-2-1-3-8-5(4)7/h1-3H,(H2,7,8) |
| InChIKey | RZJPBQGRCNJYBU-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=CC=C1Cl |
| CAS DataBase Reference | 39620-04-7(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
