393-75-9
| Name | 1,3-Dinitro-2-chloro-5-trifluoromethylbenzene |
| CAS | 393-75-9 |
| EINECS(EC#) | 206-889-3 |
| Molecular Formula | C7H2ClF3N2O4 |
| MDL Number | MFCD00007068 |
| Molecular Weight | 270.55 |
| MOL File | 393-75-9.mol |
Chemical Properties
| Appearance | yellow crystalline powder |
| Melting point | 50-55 °C (lit.) |
| Boiling point | >250°C |
| density | 1.6 |
| Fp | 126°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | water: insoluble |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility | Insoluble in water. |
| BRN | 1220937 |
| Henry's Law Constant | 1.8×101 mol/(m3Pa) at 25℃, Zhang et al. (2010) |
| Exposure limits | ACGIH: TWA 2.5 mg/m3 NIOSH: IDLH 250 mg/m3 |
| InChI | 1S/C7H2ClF3N2O4/c8-6-4(12(14)15)1-3(7(9,10)11)2-5(6)13(16)17/h1-2H |
| InChIKey | HFHAVERNVFNSHL-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(cc(c1Cl)[N+]([O-])=O)C(F)(F)F |
| LogP | 2.5 |
| CAS DataBase Reference | 393-75-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H310-H315-H319 |
| Precautionary statements | P262-P280-P301+P312+P330-P302+P352+P310-P305+P351+P338 |
| Hazard Codes | T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | XS9065000 |
| Hazard Note | Irritant |
| TSCA | T |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29049085 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |
| Hazardous Substances Data | 393-75-9(Hazardous Substances Data) |