
393-11-3
| Name | 4-Nitro-3-trifluoromethyl aniline |
| CAS | 393-11-3 |
| EINECS(EC#) | 206-884-6 |
| Molecular Formula | C7H5F3N2O2 |
| MDL Number | MFCD00014717 |
| Molecular Weight | 206.12 |
| MOL File | 393-11-3.mol |
Chemical Properties
| Appearance | lightyellowcrystalpowde |
| Melting point | 125-129 °C (lit.) |
| Boiling point | 326.4±42.0 °C(Predicted) |
| density | 1.4711 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | neat |
| pka | -0.22±0.10(Predicted) |
| color | Yellow to Orange-Yellow |
| Detection Methods | HPLC,NMR |
| BRN | 2650702 |
| InChI | InChI=1S/C7H5F3N2O2/c8-7(9,10)5-3-4(11)1-2-6(5)12(13)14/h1-3H,11H2 |
| InChIKey | UTKUVRNVYFTEHF-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C([N+]([O-])=O)C(C(F)(F)F)=C1 |
| CAS DataBase Reference | 393-11-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Amino-2-nitrobenzotrifluoride(393-11-3) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HS Code | 29214200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

Fig. The synthetic of 4-Nitro-3-trifluoromethyl aniline