38862-25-8
| Name | N-Succinimidyl Methacrylate |
| CAS | 38862-25-8 |
| Molecular Formula | C8H9NO4 |
| MDL Number | MFCD15072193 |
| Molecular Weight | 183.161 |
| MOL File | 38862-25-8.mol |
Chemical Properties
| Melting point | 102.0 to 106.0 °C |
| Boiling point | 270.1±23.0 °C(Predicted) |
| density | 1.29±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C8H9NO4/c1-5(2)8(12)13-9-6(10)3-4-7(9)11/h1,3-4H2,2H3 |
| InChIKey | ACGJEMXWUYWELU-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)ON1C(=O)CCC1=O |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H332-H315-H317-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Inhalation Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |