
38748-32-2
| Name | Triptolide |
| CAS | 38748-32-2 |
| EINECS(EC#) | 683-214-2 |
| Molecular Formula | C20H24O6 |
| MDL Number | MFCD00210565 |
| Molecular Weight | 360.4 |
| MOL File | 38748-32-2.mol |
Chemical Properties
| Appearance | White Crystalline Solid |
| Melting point | 226-227°C |
| alpha | D25 -154° |
| Boiling point | 412.43°C (rough estimate) |
| density | 1.1656 (rough estimate) |
| refractive index | 1.4450 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO: soluble |
| form | solid |
| pka | 14.25±0.60(Predicted) |
| color | white to off-white |
| biological source | Tripterygium wilfordii |
| Usage | Diterpenoid triepoxide with immunosuppressant and antitumor properties. |
| Merck | 14,9747 |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO may be stored at -20°C for up to 3 months. |
| InChIKey | DFBIRQPKNDILPW-CIVMWXNOSA-N |
| SMILES | O1[C@@]32[C@]5(O[C@H]5C[C@@H]6[C@@]3(CCC7=C6COC7=O)C)[C@@H]([C@]4(O[C@H]4[C@@H]21)C(C)C)O |
| CAS DataBase Reference | 38748-32-2(CAS DataBase Reference) |
| EPA Substance Registry System | Trisoxireno[6,7:8a,9:4b,5]phenanthro[1,2-c]furan-1(3H)-one, 3b,4,4a,6,6a,7a,7b,8b,9,10-decahydro-6-hydroxy-8b-methyl-6a-(1-methylethyl)-, (3bS,4aS,5aS,6R,6aR,7aS,7bS,8aS,8bS)- (38748-32-2) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H300+H330-H361f |
| Precautionary statements | P201-P202-P260-P264-P270-P304+P340+P310 |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | YK7751000 |
| HazardClass | 6.1 |
| PackingGroup | I |
| HS Code | 29321900 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 1 Oral Repr. 2 |
| Toxicity |

