
38573-88-5
| Name | 1-Bromo-2,3-difluorobenzene |
| CAS | 38573-88-5 |
| EINECS(EC#) | 609-564-8 |
| Molecular Formula | C6H3BrF2 |
| MDL Number | MFCD00061136 |
| Molecular Weight | 192.99 |
| MOL File | 38573-88-5.mol |
Chemical Properties
| Appearance | Clear colorless to peach liquid |
| Boiling point | 234 °C (765 mmHg) |
| density | 1.724 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 142 °F |
| storage temp. | Sealed in dry,2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.724 |
| Usage | intermediate for liquid crystal and drugs |
| InChI | InChI=1S/C6H3BrF2/c7-4-2-1-3-5(8)6(4)9/h1-3H |
| InChIKey | RKWWASUTWAFKHA-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC(F)=C1F |
| CAS DataBase Reference | 38573-88-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P210e-P280a-P405-P501a-P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501 |
| Hazard Codes | Xi,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 1993 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

Fig The synthetic method of 1-Bromo-2,3-difluorobenzene