3761-53-3
| Name | ACID RED 26 |
| CAS | 3761-53-3 |
| EINECS(EC#) | 223-178-3 |
| Molecular Formula | C18H14N2Na2O7S2 |
| MDL Number | MFCD00003897 |
| Molecular Weight | 480.42 |
| MOL File | 3761-53-3.mol |
Chemical Properties
| Appearance | dark red to bordeaux fine powder |
| Melting point | >300℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Water (Slightly) |
| Colour Index | 16150 |
| form | Fine Powder |
| color | Dark red to bordeaux |
| Water Solubility | water: 10mg/mL, clear, red |
| BRN | 5709350 |
| Stability: | Hygroscopic |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChIKey | USLDTWOAUIUWGX-LLIZZRELSA-N |
| SMILES | N(/C1=C(C(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=CC=C12)O)=N\C1C=CC(C)=CC=1C.[NaH] |
| IARC | 2B (Vol. 8, Sup 7) 1987 |
| EPA Substance Registry System | C.I. Food Red 5 (3761-53-3) |
Safety Data
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H351 |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| Hazard Codes | Xn,T |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | QJ6825000 |
| TSCA | TSCA listed |
| HS Code | 32041200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 |
| Safety Profile | |
| Hazardous Substances Data | 3761-53-3(Hazardous Substances Data) |