37342-97-5
| Name | Bis(cyclopentadienyl)zirconium chloride hydride |
| CAS | 37342-97-5 |
| EINECS(EC#) | 253-479-5 |
| Molecular Formula | C10H11ClZr |
| MDL Number | MFCD02089401 |
| Molecular Weight | 257.87 |
| MOL File | 37342-97-5.mol |
Chemical Properties
| Appearance | white to beige powder |
| Melting point | 300 °C |
| storage temp. | 2-8°C |
| form | Powder |
| color | off-white |
| Water Solubility | reacts |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | Light, Air & Moisture Sensitive |
| Merck | 14,8396 |
| Exposure limits | ACGIH: TWA 5 mg/m3; STEL 10 mg/m3 NIOSH: IDLH 25 mg/m3; TWA 5 mg/m3; STEL 10 mg/m3 |
| InChI | InChI=1S/2C5H5.ClH.Zr.H/c2*1-2-4-5-3-1;;;/h2*1-3H,4H2;1H;;/q;;;+2;-1/p-1 |
| InChIKey | DWFXOSDSYIGRKR-UHFFFAOYSA-M |
| SMILES | [Zr+2](C1CC=CC=1)C1CC=CC=1.[Cl-].[H-] |
| CAS DataBase Reference | 37342-97-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H261-H314 |
| Precautionary statements | P223-P231+P232-P260-P280-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | F,C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3131 4.3/PG 2 |
| WGK Germany | 3 |
| F | 8-10-23 |
| HazardClass | 4.3 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Skin Corr. 1B Water-react 2 |
;