
3718-88-5
| Name | 3-Iodobenzylamine hydrochloride |
| CAS | 3718-88-5 |
| EINECS(EC#) | 223-068-5 |
| Molecular Formula | C7H9ClIN |
| MDL Number | MFCD00012857 |
| Molecular Weight | 269.51 |
| MOL File | 3718-88-5.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 188-190 °C(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| color | White to Light yellow |
| Sensitive | Light Sensitive |
| BRN | 5352277 |
| InChI | InChI=1S/C7H8IN.ClH/c8-7-3-1-2-6(4-7)5-9;/h1-4H,5,9H2;1H |
| InChIKey | PYFDZOCGFHIRST-UHFFFAOYSA-N |
| SMILES | C(C1C=CC=C(I)C=1)N.Cl |
| CAS DataBase Reference | 3718-88-5(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi,T |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant/Light Sensitive |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Repr. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |