3674-13-3
| Name | Ethyl 2,3-dibromopropionate |
| CAS | 3674-13-3 |
| EINECS(EC#) | 222-941-8 |
| Molecular Formula | C5H8Br2O2 |
| MDL Number | MFCD00000212 |
| Molecular Weight | 259.92 |
| MOL File | 3674-13-3.mol |
Chemical Properties
| Appearance | clear colorless to yellow liquid |
| Boiling point | 211-214 °C/746 mmHg (lit.) |
| density | 1.788 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 197 °F |
| storage temp. | Store below +30°C. |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.785 |
| Water Solubility | Insoluble |
| BRN | 636046 |
| InChI | InChI=1S/C5H8Br2O2/c1-2-9-5(8)4(7)3-6/h4H,2-3H2,1H3 |
| InChIKey | OENICUBCLXKLJQ-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(Br)CBr |
| CAS DataBase Reference | 3674-13-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Propanoic acid, 2,3-dibromo-, ethyl ester(3674-13-3) |
| EPA Substance Registry System | 3674-13-3(EPA Substance) |
