3674-13-3
| Name | Ethyl 2,3-dibromopropionate |
| CAS | 3674-13-3 |
| EINECS(EC#) | 222-941-8 |
| Molecular Formula | C5H8Br2O2 |
| MDL Number | MFCD00000212 |
| Molecular Weight | 259.92 |
| MOL File | 3674-13-3.mol |
Chemical Properties
| Appearance | clear colorless to yellow liquid |
| Boiling point | 211-214 °C/746 mmHg (lit.) |
| density | 1.788 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 197 °F |
| storage temp. | Store below +30°C. |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.785 |
| Water Solubility | Insoluble |
| BRN | 636046 |
| InChI | InChI=1S/C5H8Br2O2/c1-2-9-5(8)4(7)3-6/h4H,2-3H2,1H3 |
| InChIKey | OENICUBCLXKLJQ-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(Br)CBr |
| CAS DataBase Reference | 3674-13-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Propanoic acid, 2,3-dibromo-, ethyl ester(3674-13-3) |
| EPA Substance Registry System | 3674-13-3(EPA Substance) |
Safety Data
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311-H314 |
| Precautionary statements | P270-P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2922 8/PG 2 |
| WGK Germany | 2 |
| RTECS | UA2458382 |
| F | 19-21 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159080 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral Eye Dam. 1 Skin Corr. 1B |
| Safety Profile | |
| Toxicity |
