367-30-6
| Name | 2,5-Difluoroaniline |
| CAS | 367-30-6 |
| EINECS(EC#) | 206-690-1 |
| Molecular Formula | C6H5F2N |
| MDL Number | MFCD00007651 |
| Molecular Weight | 129.11 |
| MOL File | 367-30-6.mol |
Chemical Properties
| Appearance | clear brown liquid |
| Melting point | 11-13 °C (lit.) |
| Boiling point | 176-178 °C (lit.) |
| density | 1.288 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 156 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| pka | 2.19±0.10(Predicted) |
| color | Colorless to Yellow to Orange |
| Specific Gravity | 1.29 |
| Water Solubility | Not miscible in water. |
| Detection Methods | HPLC |
| BRN | 2802549 |
| InChI | InChI=1S/C6H5F2N/c7-4-1-2-5(8)6(9)3-4/h1-3H,9H2 |
| InChIKey | YNOOQIUSYGWMSS-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(F)=CC=C1F |
| CAS DataBase Reference | 367-30-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 2,5-difluoro-(367-30-6) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2941 |
| WGK Germany | 3 |
| F | 8-10-23 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214210 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Skin Sens. 1 |
