3665-80-3
| Name | N-ETHYL-4-NITROANILINE |
| CAS | 3665-80-3 |
| EINECS(EC#) | 222-927-1 |
| Molecular Formula | C8H10N2O2 |
| MDL Number | MFCD00010647 |
| Molecular Weight | 166.18 |
| MOL File | 3665-80-3.mol |
Chemical Properties
| Appearance | purple-black crystals, or yellow crystals with a blue-violet lustre |
| Melting point | 96-98 °C(lit.) |
| Boiling point | 302.3±25.0 °C(Predicted) |
| density | 1.210±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| form | solid |
| pka | 0.98±0.32(Predicted) |
| Stability: | Stable, but may be air sensitive. Incompatible with strong oxidizing agents, strong bases. |
| InChI | InChI=1S/C8H10N2O2/c1-2-9-7-3-5-8(6-4-7)10(11)12/h3-6,9H,2H2,1H3 |
| InChIKey | XBNNLAWQCMDISJ-UHFFFAOYSA-N |
| SMILES | C1(NCC)=CC=C([N+]([O-])=O)C=C1 |
| EPA Substance Registry System | N-Ethyl-p-nitroaniline (3665-80-3) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |