366-99-4
| Name | 3-Fluoro-4-methoxyaniline |
| CAS | 366-99-4 |
| EINECS(EC#) | 627-615-2 |
| Molecular Formula | C7H8FNO |
| MDL Number | MFCD00075040 |
| Molecular Weight | 141.14 |
| MOL File | 366-99-4.mol |
Chemical Properties
| Appearance | light beige to yellow-brown crystalline powder |
| Melting point | 81-83 °C (lit.) |
| Boiling point | 135 °C/18 mmHg (lit.) |
| density | 1.1382 (estimate) |
| Fp | >110°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| pka | 4.18±0.10(Predicted) |
| color | Light beige to yellow-brown |
| BRN | 2717083 |
| InChI | InChI=1S/C7H8FNO/c1-10-7-3-2-5(9)4-6(7)8/h2-4H,9H2,1H3 |
| InChIKey | LJWAPDSCYTZUJU-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(OC)C(F)=C1 |
| CAS DataBase Reference | 366-99-4(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn,Xi,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
