36405-47-7
| Name | 2,2,3,4,4,4-Hexafluorobutyl methacrylate |
| CAS | 36405-47-7 |
| EINECS(EC#) | 628-322-2 |
| Molecular Formula | C8H8F6O2 |
| MDL Number | MFCD00042311 |
| Molecular Weight | 250.14 |
| MOL File | 36405-47-7.mol |
Chemical Properties
| Appearance | clear colorless liquid |
| Boiling point | 158 °C (lit.) |
| density | 1.348 g/mL at 25 °C(lit.) |
| vapor pressure | 0.25 psi ( 20 °C) |
| refractive index | n |
| Fp | 134 °F |
| storage temp. | 0-6°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.348 |
| Water Solubility | Difficult to mix in water. |
| Sensitive | Lachrymatory |
| BRN | 2725177 |
| InChI | 1S/C8H8F6O2/c1-4(2)5(15)16-3-7(10,11)6(9)8(12,13)14/h6H,1,3H2,2H3 |
| InChIKey | DFVPUWGVOPDJTC-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC(F)(F)C(F)C(F)(F)F |
| CAS DataBase Reference | 36405-47-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1H,1H,3H-Perfluorobutyl 2-methylacrylate (36405-47-7) |
Safety Data
| Hazard Codes | Xi,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Lachrymatory |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29161400 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |