3584-66-5
| Name | 5-CHLORO-2-(TRICHLOROMETHYL)BENZIMIDAZOLE |
| CAS | 3584-66-5 |
| EINECS(EC#) | 222-713-8 |
| Molecular Formula | C8H4Cl4N2 |
| MDL Number | MFCD00005595 |
| Molecular Weight | 269.94 |
| MOL File | 3584-66-5.mol |
Chemical Properties
| Appearance | light beige to light brown powder |
| Melting point | 223-224 °C (dec.)(lit.) |
| Boiling point | 419.39°C (rough estimate) |
| density | 1.7547 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Powder |
| color | Light beige to light brown |
| InChI | 1S/C8H4Cl4N2/c9-4-1-2-5-6(3-4)14-7(13-5)8(10,11)12/h1-3H,(H,13,14) |
| InChIKey | SIZGSKQSWJIWFP-UHFFFAOYSA-N |
| SMILES | Clc1ccc2[nH]c(nc2c1)C(Cl)(Cl)Cl |
| CAS DataBase Reference | 3584-66-5 |
Safety Data
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29339980 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |