35231-44-8
| Name | 4-Bromomethyl-7-methoxycoumarin |
| CAS | 35231-44-8 |
| EINECS(EC#) | 252-448-3 |
| Molecular Formula | C11H9BrO3 |
| MDL Number | MFCD00006869 |
| Molecular Weight | 269.09 |
| MOL File | 35231-44-8.mol |
Chemical Properties
| Appearance | Light Green-Yellow Crystals |
| Melting point | 213-215 °C (lit.) |
| Boiling point | 385.3±42.0 °C(Predicted) |
| density | 1.552±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | chloroform: soluble20mg/mL, clear, colorless to faintly yellow |
| form | Powder and/or Chunks |
| color | Off-white to light yellow or beige |
| Stability: | Stable, but moisture and light-sensitive. Combustible. Incompatible with strong oxidizing agents. |
| Water Solubility | insoluble |
| Usage | Used for derivatization, TLC and HPLC separation, and fluorometric analysis of a wide range of naturally occurring acids, including bile and thromboxane B2 |
| λmax | 330 nm (MeOH) |
| BRN | 187211 |
| Biological Applications | Analyzing/detecting carboxylic acids;analyzing/labeling fatty acids; detecting nitric oxide; detecting/separating bile acids; labeling pyrimidine nucleobases; anticancer agents; biomedical trace analysis; herbicides; as a substrate for measuring histone acetyltransferases (HATs) activity, peptidases activity, sirtuin activity |
| Major Application | Detection of nitrated explosives; measuring ultraviolet ray power; photoacid generators; polyurethane foams; photoresists silica nanoparticles |
| InChI | 1S/C11H9BrO3/c1-14-8-2-3-9-7(6-12)4-11(13)15-10(9)5-8/h2-5H,6H2,1H3 |
| InChIKey | CTENSLORRMFPDH-UHFFFAOYSA-N |
| SMILES | COc1ccc2C(CBr)=CC(=O)Oc2c1 |
| LogP | 2.730 (est) |
Safety Data
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 1759 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |