
35212-22-7
| Name | Ipriflavone |
| CAS | 35212-22-7 |
| EINECS(EC#) | 201-641-0 |
| Molecular Formula | C18H16O3 |
| MDL Number | MFCD00221719 |
| Molecular Weight | 280.32 |
| MOL File | 35212-22-7.mol |
Chemical Properties
| Appearance | white powder |
| Melting point | 116-120 °C(lit.) |
| Boiling point | 363.04°C (rough estimate) |
| density | 1.2170 (rough estimate) |
| refractive index | 1.4700 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMF:20.0(Max Conc. mg/mL);71.35(Max Conc. mM) DMF:PBS (pH 7.2) (1:4):0.2(Max Conc. mg/mL);0.71(Max Conc. mM) DMSO:33.11(Max Conc. mg/mL);118.11(Max Conc. mM) Ethanol:1.5(Max Conc. mg/mL);5.35(Max Conc. mM) |
| form | powder to crystal |
| color | White to Almost white |
| Merck | 5074 |
| InChI | InChI=1S/C18H16O3/c1-12(2)21-14-8-9-15-17(10-14)20-11-16(18(15)19)13-6-4-3-5-7-13/h3-12H,1-2H3 |
| InChIKey | SFBODOKJTYAUCM-UHFFFAOYSA-N |
| SMILES | C1OC2=CC(OC(C)C)=CC=C2C(=O)C=1C1=CC=CC=C1 |
| LogP | 4.245 (est) |
| CAS DataBase Reference | 35212-22-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | DJ3100500 |
| HS Code | 29329990 |
