3453-33-6
| Name | 6-Methoxy-2-naphthaldehyde |
| CAS | 3453-33-6 |
| EINECS(EC#) | 222-377-2 |
| Molecular Formula | C12H10O2 |
| MDL Number | MFCD00081152 |
| Molecular Weight | 186.21 |
| MOL File | 3453-33-6.mol |
Chemical Properties
| Appearance | yellow to beige-yellow crystals or crystalline |
| Melting point | 81-84 °C(lit.) |
| Boiling point | 196 °C / 10mmHg |
| density | 1.169±0.06 g/cm3(Predicted) |
| vapor pressure | 0.022Pa at 25℃ |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly, Sonicated) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| Water Solubility | 150.1mg/L at 25℃ |
| Sensitive | Air Sensitive |
| Detection Methods | HPLC,NMR |
| BRN | 1945989 |
| InChI | InChI=1S/C12H10O2/c1-14-12-5-4-10-6-9(8-13)2-3-11(10)7-12/h2-8H,1H3 |
| InChIKey | VZBLASFLFFMMCM-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C(OC)C=C2)=CC=C1C=O |
| LogP | 2.97 at 25℃ |
| CAS DataBase Reference | 3453-33-6(CAS DataBase Reference) |
| Storage Precautions | Store under nitrogen |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29124990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |