
341031-54-7
| Name | N-(2-(Diethylamino)ethyl)-5-((Z)-(5-fluoro-1,2-dihydro-2-oxo-3H-indol-3-ylidene)methyl)-2,4-dimethyl-1H-pyrrole-3-carboxamide (2S)-hydroxybutanedioate |
| CAS | 341031-54-7 |
| EINECS(EC#) | 638-825-9 |
| Molecular Formula | C22H27FN4O2.C4H6O5 |
| MDL Number | MFCD08282795 |
| Molecular Weight | 532.56 |
| MOL File | 341031-54-7.mol |
Chemical Properties
| Melting point | 189-191°C |
| storage temp. | Store at +4°C |
| solubility | DMSO: >10mg/mL |
| form | powder |
| color | Orange |
| Stability: | Stable for 2 years from date of purchase as supplied. Solutions in DMSO may be stored at -20°C for up to 3 months. |
| InChIKey | XGQXULJHBWKUJY-LYIKAWCPSA-N |
| SMILES | [C@@H](O)(C(=O)O)CC(=O)O.C(/C1NC(C)=C(C(=O)NCCN(CC)CC)C=1C)=C1/C(NC2=CC=C(F)C=C/12)=O |&1:0,r| |
| CAS DataBase Reference | 341031-54-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H360-H372 |
| Precautionary statements | P201-P308+P313 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN3077 |
| WGK Germany | 2 |
| HazardClass | 9 |
| HS Code | 29337900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1B STOT RE 1 Oral |
