3395-98-0
| Name | 5-Methyl-3-vinyl-2-oxazolidinone |
| CAS | 3395-98-0 |
| EINECS(EC#) | 809-852-5 |
| Molecular Formula | C6H9NO2 |
| MDL Number | MFCD34167271 |
| Molecular Weight | 127.14 |
| MOL File | 3395-98-0.mol |
Chemical Properties
| Boiling point | 78-81 °C(Press: 1.3 Torr) |
| density | 1.085 g/cm3 |
| vapor pressure | 2.2-25Pa at 20-50℃ |
| pka | -0.39±0.40(Predicted) |
| PH | 7.5 at 20℃ and 10g/L |
| InChI | InChI=1S/C6H9NO2/c1-3-7-4-5(2)9-6(7)8/h3,5H,1,4H2,2H3 |
| InChIKey | HXFNRRNDWNSKFM-UHFFFAOYSA-N |
| SMILES | O1C(C)CN(C=C)C1=O |
| LogP | 0.8 at 23℃ and pH6.3 |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P233-P260-P261-P264-P271-P280-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P340-P362-P403-P403+P233-P405-P501 |
| TSCA | TSCA listed |
| REACH Registrations | Active |