33685-54-0
| Name | 1,1,2,2-TETRACHLOROETHANE-D2 |
| CAS | 33685-54-0 |
| EINECS(EC#) | 251-634-1 |
| Molecular Formula | C2Cl4D2 |
| MDL Number | MFCD00037672 |
| Molecular Weight | 169.86 |
| MOL File | 33685-54-0.mol |
Chemical Properties
| Appearance | clear colorless liquid |
| Melting point | -44°C |
| Boiling point | 145-146 °C737 mm Hg(lit.) |
| density | 1.62 g/mL at 25 °C(lit.) |
| vapor pressure | 6.6 hPa (20 °C) |
| refractive index | n |
| Fp | 147°C |
| storage temp. | Storage temperature: no restrictions. |
| solubility | 3g/l |
| form | Liquid |
| color | Colorless |
| Specific Gravity | 1.62 |
| Water Solubility | Slightly soluble in water. Soluble in ether, chloroform, ethanol, tetrachloromethane, methanol, acetone, petroleum spirit, carbon disulfide, dimethyl formamide and benzene. |
| BRN | 1699903 |
| Stability: | Volatile |
| InChI | 1S/C2H2Cl4/c3-1(4)2(5)6/h1-2H/i1D,2D |
| InChIKey | QPFMBZIOSGYJDE-QDNHWIQGSA-N |
| SMILES | ClC(Cl)(C(Cl)(Cl)[2H])[2H] |
| CAS DataBase Reference | 33685-54-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H310+H330-H411 |
| Precautionary statements | P262-P273-P280-P302+P352+P310-P304+P340+P310 |
| Hazard Codes | T+,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1702 6.1/PG 2 |
| WGK Germany | 3 |
| F | 8-10 |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 28459000 |
| Storage Class | 6.1B - Non-combustible, acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Aquatic Chronic 2 |