33641-15-5
| Name | 5-Hydroxy-1-methylpyrazole |
| CAS | 33641-15-5 |
| EINECS(EC#) | 213-317-6 |
| Molecular Formula | C4H6N2O |
| MDL Number | MFCD05864418 |
| Molecular Weight | 98.1032 |
| MOL File | 33641-15-5.mol |
Chemical Properties
| Melting point | 110-114 °C |
| Boiling point | 217.7±13.0 °C(Predicted) |
| density | 1.22±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in DMSO, Methanol |
| form | powder to crystal |
| pka | 9.07±0.23(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C4H6N2O/c1-6-4(7)2-3-5-6/h2-3,7H,1H3 |
| InChIKey | CMXOTACIOGGSNH-UHFFFAOYSA-N |
| SMILES | N1(C)C(O)=CC=N1 |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933199090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
