
327-92-4
| Name | 1,5-Difluoro-2,4-dinitrobenzene |
| CAS | 327-92-4 |
| EINECS(EC#) | 206-324-0 |
| Molecular Formula | C6H2F2N2O4 |
| MDL Number | MFCD00007052 |
| Molecular Weight | 204.09 |
| MOL File | 327-92-4.mol |
Chemical Properties
| Appearance | light yellow to light brown crystalline powder |
| Melting point | 72-74 °C (lit.) |
| Boiling point | 306.8±37.0 °C(Predicted) |
| density | 1.6930 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Orange to Green |
| Water Solubility | insoluble |
| BRN | 1883116 |
| InChI | 1S/C6H2F2N2O4/c7-3-1-4(8)6(10(13)14)2-5(3)9(11)12/h1-2H |
| InChIKey | VILFTWLXLYIEMV-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(c(F)cc1F)[N+]([O-])=O |
| CAS DataBase Reference | 327-92-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,3-difluoro-4,6-dinitro-(327-92-4) |
| EPA Substance Registry System | 327-92-4(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H300-H311+H331-H373 |
| Precautionary statements | P280-P301+P310+P330-P302+P352+P312-P304+P340+P311-P314 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | CZ5663200 |
| F | 10-21 |
| Hazard Note | Toxic |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29049085 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Acute Tox. 3 Dermal Acute Tox. 3 Inhalation STOT RE 2 |

