
32315-10-9
| Name | Triphosgene |
| CAS | 32315-10-9 |
| EINECS(EC#) | 250-986-3 |
| Molecular Formula | C3Cl6O3 |
| MDL Number | MFCD00062848 |
| Molecular Weight | 296.75 |
| MOL File | 32315-10-9.mol |
Chemical Properties
| Appearance | White solid |
| Melting point | 79-83 °C (lit.) |
| Boiling point | 203-206 °C (lit.) |
| density | 1.78 |
| vapor pressure | 16 hPa (90 °C) |
| Fp | 203-206°C |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Crystalline Powder, Crystals and/or Chunks |
| color | White to off-white |
| Water Solubility | practically insoluble |
| Sensitive | Moisture Sensitive |
| BRN | 1787583 |
| InChI | 1S/C3Cl6O3/c4-2(5,6)11-1(10)12-3(7,8)9 |
| InChIKey | UCPYLLCMEDAXFR-UHFFFAOYSA-N |
| SMILES | ClC(Cl)(Cl)OC(=O)OC(Cl)(Cl)Cl |
| CAS DataBase Reference | 32315-10-9(CAS DataBase Reference) |
| EPA Substance Registry System | 32315-10-9(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H314-H330 |
| Precautionary statements | P260-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | T+,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2928 6.1/PG 2 |
| WGK Germany | 2 |
| F | 10-19-21 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29209010 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Skin Corr. 1B |

