
3141-26-2
| Name | 3,4-Dibromothiophene |
| CAS | 3141-26-2 |
| EINECS(EC#) | 221-546-8 |
| Molecular Formula | C4H2Br2S |
| MDL Number | MFCD00005465 |
| Molecular Weight | 241.93 |
| MOL File | 3141-26-2.mol |
Chemical Properties
| Appearance | clear colorless to yellow liquid |
| Melting point | 4-5 °C (lit.) |
| Boiling point | 221-222 °C (lit.) |
| density | 2.188 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Liquid |
| color | Clear colorless to yellow |
| Specific Gravity | 2.188 |
| Detection Methods | GC,NMR |
| BRN | 107642 |
| InChI | InChI=1S/C4H2Br2S/c5-3-1-7-2-4(3)6/h1-2H |
| InChIKey | VGKLVWTVCUDISO-UHFFFAOYSA-N |
| SMILES | C1SC=C(Br)C=1Br |
| CAS DataBase Reference | 3141-26-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Thiophene, 3,4-dibromo-(3141-26-2) |
| Storage Precautions | Store under nitrogen |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
