307-29-9
| Name | 1H,1H-Perfluorooctylamine |
| CAS | 307-29-9 |
| EINECS(EC#) | 671-163-9 |
| Molecular Formula | C8H4F15N |
| MDL Number | MFCD00042460 |
| Molecular Weight | 399.1 |
| MOL File | 307-29-9.mol |
Chemical Properties
| Melting point | 240-245 °C (decomp) |
| Boiling point | 75 °C |
| density | 1,714 g/cm3 |
| refractive index | 1.305 |
| Fp | 75°C/50mm |
| storage temp. | 2-8°C, protect from light |
| form | solid |
| pka | 6.05±0.30(Predicted) |
| Specific Gravity | 1.714 |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 1806966 |
| InChI | 1S/C8H4F15N/c9-2(10,1-24)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)23/h1,24H2 |
| InChIKey | HZCZXRSVKNFILZ-UHFFFAOYSA-N |
| SMILES | NCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 307-29-9(CAS DataBase Reference) |
| EPA Substance Registry System | 1H,1H-Perfluorooctylamine (307-29-9) |
Safety Data
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN2735 |
| WGK Germany | WGK 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29211990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Lact. Repr. 1B STOT RE 1 |