
3068-76-6
| Name | N-[3-(TRIMETHOXYSILYL)PROPYL]ANILINE |
| CAS | 3068-76-6 |
| EINECS(EC#) | 221-328-2 |
| Molecular Formula | C12H21NO3Si |
| MDL Number | MFCD00053673 |
| Molecular Weight | 255.39 |
| MOL File | 3068-76-6.mol |
Chemical Properties
| Appearance | Yellowish clear liquid |
| Melting point | <0°C |
| Boiling point | 310 °C(lit.) |
| density | 1.07 g/mL at 25 °C(lit.) |
| vapor pressure | 0-0.042Pa at 25℃ |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | 2-8°C, protect from light |
| form | liquid |
| pka | 5.02±0.50(Predicted) |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.07 |
| Water Solubility | 993-1000000mg/L at 20℃ |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 8620045 |
| InChI | 1S/C12H21NO3Si/c1-14-17(15-2,16-3)11-7-10-13-12-8-5-4-6-9-12/h4-6,8-9,13H,7,10-11H2,1-3H3 |
| InChIKey | KBJFYLLAMSZSOG-UHFFFAOYSA-N |
| SMILES | CO[Si](CCCNc1ccccc1)(OC)OC |
Safety Data
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3267 8/PG 2 |
| WGK Germany | 1 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 3 Carc. 2 Eye Dam. 1 Muta. 2 Skin Corr. 1B Skin Sens. 1 STOT RE 1 |