
30674-80-7
| Name | 2-Isocyanatoethyl methacrylate |
| CAS | 30674-80-7 |
| EINECS(EC#) | 250-284-7 |
| Molecular Formula | C7H9NO3 |
| MDL Number | MFCD03458122 |
| Molecular Weight | 155.15 |
| MOL File | 30674-80-7.mol |
Chemical Properties
| Melting point | −45 °C(lit.) |
| Boiling point | 211 °C(lit.) |
| density | 1.098 g/mL at 25 °C(lit.) |
| vapor pressure | 18Pa at 20℃ |
| refractive index | n |
| Fp | 207 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | 4.214g/L at 25℃ |
| InChI | InChI=1S/C7H9NO3/c1-6(2)7(10)11-4-3-8-5-9/h1,3-4H2,2H3 |
| InChIKey | RBQRWNWVPQDTJJ-UHFFFAOYSA-N |
| SMILES | C(OCCN=C=O)(=O)C(C)=C |
| LogP | 1.72 |
| EPA Substance Registry System | 2-Propenoic acid, 2-methyl-, 2-isocyanatoethyl ester(30674-80-7) |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H318-H330-H334 |
| Precautionary statements | P260-P280-P301+P312-P302+P352-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | T+,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2206 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | OZ4950000 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29291090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 4 Oral Eye Dam. 1 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 |
| Hazardous Substances Data | 30674-80-7(Hazardous Substances Data) |
| Toxicity |


