2960-93-2
| Name | (R)-(+)-2,2'-DIMETHOXY-1,1'-BINAPHTHYL |
| CAS | 2960-93-2 |
| Molecular Formula | C22H18O2 |
| MDL Number | MFCD00091146 |
| Molecular Weight | 314.38 |
| MOL File | 2960-93-2.mol |
Chemical Properties
| Appearance | white to beige crystalline powder |
| Melting point | 227-231 °C(lit.) |
| Boiling point | 414.05°C (rough estimate) |
| density | 1.160 |
| refractive index | 1.5100 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| color | White to beige |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C22H18O2/c1-23-19-13-11-15-7-3-5-9-17(15)21(19)22-18-10-6-4-8-16(18)12-14-20(22)24-2/h3-14H,1-2H3 |
| InChIKey | BJAADAKPADTRCH-UHFFFAOYSA-N |
| SMILES | C1(C2=C3C(C=CC=C3)=CC=C2OC)=C2C(C=CC=C2)=CC=C1OC |
Safety Data
| Hazard Codes | Xi,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| HazardClass | 9 |
| HS Code | 29093090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |