2942-42-9
| Name | 7-Nitroindazole |
| CAS | 2942-42-9 |
| EINECS(EC#) | 220-934-4 |
| Molecular Formula | C7H5N3O2 |
| MDL Number | MFCD00022789 |
| Molecular Weight | 163.13 |
| MOL File | 2942-42-9.mol |
Chemical Properties
| Appearance | yellow powder |
| Melting point | 185-186°C |
| Boiling point | 290.19°C (rough estimate) |
| density | 1.4141 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | −20°C |
| solubility | Soluble to 100 mM in DMSO and to 20 mM in ethanol |
| form | powder to crystal |
| pka | 10.03±0.40(Predicted) |
| color | Light yellow to Brown |
| Water Solubility | slightly soluble |
| Usage | A potent, selective brain inhibitor of mouse cerebellar Nitric Oxide Synthase. |
| BRN | 6809 |
| InChI | InChI=1S/C7H5N3O2/c11-10(12)6-3-1-2-5-4-8-9-7(5)6/h1-4H,(H,8,9) |
| InChIKey | PQCAUHUKTBHUSA-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2[N+]([O-])=O)C=N1 |
| CAS DataBase Reference | 2942-42-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 7-Nitroindazole(2942-42-9) |
Safety Data
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | NK7962200 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29339900 |