2905-60-4
| Name | 2,3-Dichlorobenzoyl chloride |
| CAS | 2905-60-4 |
| EINECS(EC#) | 220-811-5 |
| Molecular Formula | C7H3Cl3O |
| MDL Number | MFCD00035937 |
| Molecular Weight | 209.46 |
| MOL File | 2905-60-4.mol |
Chemical Properties
| Melting point | 30-32°C |
| Boiling point | 140°C 14mm |
| density | 1.498±0.06 g/cm3(Predicted) |
| Fp | 167°C |
| solubility | soluble in Toluene |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 2575973 |
| InChI | InChI=1S/C7H3Cl3O/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H |
| InChIKey | YBONBWJSFMTXLE-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC=CC(Cl)=C1Cl |
| CAS DataBase Reference | 2905-60-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2905-60-4(EPA Substance) |
Safety Data
| Symbol(GHS) |    GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H314-H410 |
| Precautionary statements | P260-P273-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3261 |
| WGK Germany | 1 |
| Hazard Note | Corrosive |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Corr. 1B |
| Hazardous Substances Data | 2905-60-4(Hazardous Substances Data) |