2789-92-6
Name | 3,5-Dichloroanthranilic acid |
CAS | 2789-92-6 |
EINECS(EC#) | 220-520-3 |
Molecular Formula | C7H5Cl2NO2 |
MDL Number | MFCD00017088 |
Molecular Weight | 206.03 |
MOL File | 2789-92-6.mol |
Chemical Properties
Appearance | off-white to yellow to dark pink |
Melting point | 227-230 °C(lit.) |
Boiling point | 344.4±42.0 °C(Predicted) |
density | 1.4062 (rough estimate) |
refractive index | 1.6100 (estimate) |
storage temp. | Storage temperature: no restrictions. |
solubility | Acetic Acid (Slightly, Heated), DMSO (Slightly) |
form | Solid |
pka | 4.20±0.10(Predicted) |
color | White to Pale Yellow |
Water Solubility | insoluble |
BRN | 779100 |
InChI | InChI=1S/C7H5Cl2NO2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H,10H2,(H,11,12) |
InChIKey | KTHTXLUIEAIGCD-UHFFFAOYSA-N |
SMILES | C(O)(=O)C1=CC(Cl)=CC(Cl)=C1N |
CAS DataBase Reference | 2789-92-6(CAS DataBase Reference) |
Safety Data
Hazard Codes | Xi |
Risk Statements | |
Safety Statements | |
WGK Germany | 2 |
RTECS | CB2800000 |
HS Code | 29224985 |
Toxicity |