2772-45-4
| Name | 2,4-BIS(ALPHA,ALPHA-DIMETHYLBENZYL)PHENOL |
| CAS | 2772-45-4 |
| EINECS(EC#) | 220-466-0 |
| Molecular Formula | C24H26O |
| MDL Number | MFCD00191242 |
| Molecular Weight | 330.46 |
| MOL File | 2772-45-4.mol |
Chemical Properties
| Melting point | 63-65 °C(lit.) |
| Boiling point | 206 °C15 mm Hg(lit.) |
| density | 1.063 |
| refractive index | 1.6380 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 10.71±0.10(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C24H26O/c1-23(2,18-11-7-5-8-12-18)20-15-16-22(25)21(17-20)24(3,4)19-13-9-6-10-14-19/h5-17,25H,1-4H3 |
| InChIKey | FMUYQRFTLHAARI-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(C(C)(C2=CC=CC=C2)C)C=C1C(C)(C1=CC=CC=C1)C |
| CAS DataBase Reference | 2772-45-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2,4-Bis(1-methyl-1-phenylethyl)phenol (2772-45-4) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H413 |
| Precautionary statements | P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2907.19.8000 |
| REACH Registrations | Inactive |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 |