
27469-60-9
| Name | 4,4'-Difluorobenzhydrylpiperazine |
| CAS | 27469-60-9 |
| EINECS(EC#) | 248-476-0 |
| Molecular Formula | C17H18F2N2 |
| MDL Number | MFCD00038660 |
| Molecular Weight | 288.34 |
| MOL File | 27469-60-9.mol |
Chemical Properties
| Appearance | white to yellow crystalline powder |
| Melting point | 88-92 °C(lit.) |
| Boiling point | 130 °C |
| density | 1.1462 (estimate) |
| vapor pressure | 0.001-0.003Pa at 20-25℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol,Toluene |
| form | Crystalline Powder |
| pka | 9.00±0.10(Predicted) |
| color | White to yellow |
| Water Solubility | 0.34 g/L (20 ºC) |
| BRN | 620754 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C17H18F2N2/c18-15-5-1-13(2-6-15)17(21-11-9-20-10-12-21)14-3-7-16(19)8-4-14/h1-8,17,20H,9-12H2 |
| InChIKey | TTXIFFYPVGWLSE-UHFFFAOYSA-N |
| SMILES | N1(C(C2=CC=C(F)C=C2)C2=CC=C(F)C=C2)CCNCC1 |
| LogP | 3.3-3.5 at pH7-11 |
| CAS DataBase Reference | 27469-60-9(CAS DataBase Reference) |
Safety Data
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| F | 10-34 |
| Hazard Note | Toxic |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29335990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 2 Eye Dam. 1 Skin Sens. 1A |