2736-23-4
| Name | 2,4-Dichloro-5-sulfamoylbenzoic acid |
| CAS | 2736-23-4 |
| EINECS(EC#) | 220-358-3 |
| Molecular Formula | C7H5Cl2NO4S |
| MDL Number | MFCD00007931 |
| Molecular Weight | 270.09 |
| MOL File | 2736-23-4.mol |
Chemical Properties
| Appearance | white to off-white crystalline powder |
| Melting point | 230-232 °C (dec.)(lit.) |
| Boiling point | 503.8±60.0 °C(Predicted) |
| density | 1.5426 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 2.08±0.25(Predicted) |
| color | White to Off-White |
| Water Solubility | insoluble |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1S/C7H5Cl2NO4S/c8-4-2-5(9)6(15(10,13)14)1-3(4)7(11)12/h1-2H,(H,11,12)(H2,10,13,14) |
| InChIKey | ZSHHRBYVHTVRFK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(S(N)(=O)=O)=C(Cl)C=C1Cl |
| CAS DataBase Reference | 2736-23-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H303-H335-H315-H318 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P310-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | DG8100000 |
| REACH Registrations | Active |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |