271-29-4
| Name | 6-Azaindole |
| CAS | 271-29-4 |
| EINECS(EC#) | 664-233-5 |
| Molecular Formula | C7H6N2 |
| MDL Number | MFCD06738911 |
| Molecular Weight | 118.14 |
| MOL File | 271-29-4.mol |
Chemical Properties
| Melting point | 136-137°C |
| Boiling point | 295.8±13.0 °C(Predicted) |
| density | 1.242±0.06 g/cm3(Predicted) |
| RTECS | UY8720000 |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| form | Solid |
| pka | 14.66±0.30(Predicted) |
| Appearance | Off-white to light brown Solid |
| Water Solubility | Soluble in water (hardly), methanol and chloroform. |
| Sensitive | Air & Light Sensitive |
| InChI | InChI=1S/C7H6N2/c1-3-8-5-7-6(1)2-4-9-7/h1-5,9H |
| InChIKey | XLKDJOPOOHHZAN-UHFFFAOYSA-N |
| SMILES | C1=NC=CC2C=CNC1=2 |
| CAS DataBase Reference | 271-29-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HS Code | 29339980 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| Toxicity |
![7-CHLORO-1H-PYRROLO[2,3-C]PYRIDINE](/CAS/GIF/357263-41-3.gif)
