27043-05-6
| Name | 2-Ethyl-3,5-dimethylpyrazine |
| CAS | 27043-05-6 |
| EINECS(EC#) | 248-182-2 |
| Molecular Formula | C8H12N2 |
| MDL Number | MFCD00047392 |
| Molecular Weight | 136.19 |
| MOL File | 27043-05-6.mol |
Chemical Properties
| Appearance | clear light yellow liquid |
| Boiling point | 180-181 °C(lit.) |
| density | 0.965 g/mL at 25 °C(lit.) |
| FEMA | 3149 |
| refractive index | n |
| Fp | 157 °F |
| storage temp. | 2-8°C |
| form | neat |
| color | Colorless to Light yellow |
| Odor | at 0.10 % in dipropylene glycol. burnt coffee nutty roasted woody |
| biological source | synthetic |
| Odor Type | burnt |
| JECFA Number | 775 |
| Major Application | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/2C8H12N2/c1-4-8-7(3)10-6(2)5-9-8;1-4-8-7(3)9-5-6(2)10-8/h2*5H,4H2,1-3H3 |
| InChIKey | BOFLOMVCGPWPQC-UHFFFAOYSA-N |
| SMILES | CCc1ncc(C)nc1C.CCc2nc(C)cnc2C |
| CAS DataBase Reference | 27043-05-6(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2915.39.3500 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |